C16H13Cl3F3N3O2S — CID 3521948
2,5-dichloro-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methyl-N-prop-2-enylbenzenesulfonohydrazide (PubChem CID 3521948) has the molecular formula C16H13Cl3F3N3O2S and a molecular weight of 474.72 g/mol. Its IUPAC name is 2,5-dichloro-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methyl-N-prop-2-enylbenzenesulfonohydrazide.
| Compound Name | 2,5-dichloro-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methyl-N-prop-2-enylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 3521948 |
| Molecular Formula | C16H13Cl3F3N3O2S |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 472.97 |
| IUPAC Name | 2,5-dichloro-N'-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N'-methyl-N-prop-2-enylbenzenesulfonohydrazide |
| SMILES | C=CCN(N(C)c1ncc(C(F)(F)F)cc1Cl)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H13Cl3F3N3O2S/c1-3-6-25(28(26,27)14-8-11(17)4-5-12(14)18)24(2)15-13(19)7-10(9-23-15)16(20,21)22/h3-5,7-9H,1,6H2,2H3 |
| InChIKey | LSNAESLCPDPZTM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|