C23H29N3O2S — CID 35223508
N-(4-methylsulfanylphenyl)-2-[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]acetamide (PubChem CID 35223508) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-2-[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-methylsulfanylphenyl)-2-[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 35223508 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-2-[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]acetamide |
| SMILES | CSc1ccc(NC(=O)CN2CCN(C(=O)c3ccc(C(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O2S/c1-17(2)18-4-6-19(7-5-18)23(28)26-14-12-25(13-15-26)16-22(27)24-20-8-10-21(29-3)11-9-20/h4-11,17H,12-16H2,1-3H3,(H,24,27) |
| InChIKey | NFEVPMPCVXHGLZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |