C23H29NO5 — CID 3522390
1-[(4-ethoxy-3-methoxyphenyl)-(3-methoxyphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 3522390) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-[(4-ethoxy-3-methoxyphenyl)-(3-methoxyphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(4-ethoxy-3-methoxyphenyl)-(3-methoxyphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3522390 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-[(4-ethoxy-3-methoxyphenyl)-(3-methoxyphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | CCOc1ccc(C(c2cccc(OC)c2)N2CCC(C(=O)O)CC2)cc1OC |
| InChI | InChI=1S/C23H29NO5/c1-4-29-20-9-8-18(15-21(20)28-3)22(17-6-5-7-19(14-17)27-2)24-12-10-16(11-13-24)23(25)26/h5-9,14-16,22H,4,10-13H2,1-3H3,(H,25,26) |
| InChIKey | QRGTVQPJOWOWMM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |