C30H23N3O2 — CID 3522437
1-benzyl-4,10a-diphenyl-5,10-dihydropyrrolo[2,3-b][1,5]benzodiazepine-2,3-dione (PubChem CID 3522437) has the molecular formula C30H23N3O2 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-benzyl-4,10a-diphenyl-5,10-dihydropyrrolo[2,3-b][1,5]benzodiazepine-2,3-dione.
| Compound Name | 1-benzyl-4,10a-diphenyl-5,10-dihydropyrrolo[2,3-b][1,5]benzodiazepine-2,3-dione |
|---|---|
| PubChem CID | 3522437 |
| Molecular Formula | C30H23N3O2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-benzyl-4,10a-diphenyl-5,10-dihydropyrrolo[2,3-b][1,5]benzodiazepine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccccc2)C2(c3ccccc3)Nc3ccccc3NC(c3ccccc3)=C12 |
| InChI | InChI=1S/C30H23N3O2/c34-28-26-27(22-14-6-2-7-15-22)31-24-18-10-11-19-25(24)32-30(26,23-16-8-3-9-17-23)33(29(28)35)20-21-12-4-1-5-13-21/h1-19,31-32H,20H2 |
| InChIKey | PTMWVSDJFFFPIZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|