C30H26N2O6 — CID 3522785
5-benzyl-3-(carboxymethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3522785) has the molecular formula C30H26N2O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is 5-benzyl-3-(carboxymethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-benzyl-3-(carboxymethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3522785 |
| Molecular Formula | C30H26N2O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 5-benzyl-3-(carboxymethyl)-4,6-dioxo-1-[4-(2-phenylethenyl)phenyl]-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)CC1(C(=O)O)NC(c2ccc(C=Cc3ccccc3)cc2)C2C(=O)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C30H26N2O6/c33-23(34)17-30(29(37)38)25-24(27(35)32(28(25)36)18-21-9-5-2-6-10-21)26(31-30)22-15-13-20(14-16-22)12-11-19-7-3-1-4-8-19/h1-16,24-26,31H,17-18H2,(H,33,34)(H,37,38) |
| InChIKey | LGOOVHBBFVNBQL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|