C14H18ClNO4S — CID 35230890
4-chloro-3-methylsulfonyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzamide (PubChem CID 35230890) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is 4-chloro-3-methylsulfonyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzamide.
| Compound Name | 4-chloro-3-methylsulfonyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 35230890 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 4-chloro-3-methylsulfonyl-N-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H18ClNO4S/c1-9(12-4-3-7-20-12)16-14(17)10-5-6-11(15)13(8-10)21(2,18)19/h5-6,8-9,12H,3-4,7H2,1-2H3,(H,16,17)/t9-,12-/m0/s1 |
| InChIKey | XFTHJSGKQBHGDI-CABZTGNLSA-N |
| XLogP | 2.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |