C21H20ClN3O3S — CID 3523407
(4-chlorophenyl)methyl 4-hydroxy-1,3-dimethyl-N-(3-methylphenyl)-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3523407) has the molecular formula C21H20ClN3O3S and a molecular weight of 429.93 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 4-hydroxy-1,3-dimethyl-N-(3-methylphenyl)-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | (4-chlorophenyl)methyl 4-hydroxy-1,3-dimethyl-N-(3-methylphenyl)-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3523407 |
| Molecular Formula | C21H20ClN3O3S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | (4-chlorophenyl)methyl 4-hydroxy-1,3-dimethyl-N-(3-methylphenyl)-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cc1cccc(/N=C(\SCc2ccc(Cl)cc2)c2c(O)n(C)c(=O)n(C)c2=O)c1 |
| InChI | InChI=1S/C21H20ClN3O3S/c1-13-5-4-6-16(11-13)23-18(29-12-14-7-9-15(22)10-8-14)17-19(26)24(2)21(28)25(3)20(17)27/h4-11,26H,12H2,1-3H3/b23-18- |
| InChIKey | KQCJPLHVFKMHQO-NKFKGCMQSA-N |
| XLogP | 3.76 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|