C11H15NO2S — CID 35235171
N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]thiophene-3-carboxamide (PubChem CID 35235171) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]thiophene-3-carboxamide.
| Compound Name | N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 35235171 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]thiophene-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccsc1)[C@H]1CCCO1 |
| InChI | InChI=1S/C11H15NO2S/c1-8(10-3-2-5-14-10)12-11(13)9-4-6-15-7-9/h4,6-8,10H,2-3,5H2,1H3,(H,12,13)/t8-,10-/m1/s1 |
| InChIKey | SFJKNDIVYVURHW-PSASIEDQSA-N |
| XLogP | 2.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |