C14H16Cl2N2O — CID 3523885
N-(1-azabicyclo[2.2.2]octan-3-yl)-2,4-dichlorobenzamide (PubChem CID 3523885) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-2,4-dichlorobenzamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3523885 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-2,4-dichlorobenzamide |
| SMILES | O=C(NC1CN2CCC1CC2)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2N2O/c15-10-1-2-11(12(16)7-10)14(19)17-13-8-18-5-3-9(13)4-6-18/h1-2,7,9,13H,3-6,8H2,(H,17,19) |
| InChIKey | VJRQXKBXZHNOHO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |