C23H24ClN3O2 — CID 35239031
1-benzyl-3-(4-chlorophenyl)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]pyrazole-4-carboxamide (PubChem CID 35239031) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 1-benzyl-3-(4-chlorophenyl)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-3-(4-chlorophenyl)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 35239031 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-benzyl-3-(4-chlorophenyl)-N-[(1R)-1-[(2R)-oxolan-2-yl]ethyl]pyrazole-4-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cn(Cc2ccccc2)nc1-c1ccc(Cl)cc1)[C@H]1CCCO1 |
| InChI | InChI=1S/C23H24ClN3O2/c1-16(21-8-5-13-29-21)25-23(28)20-15-27(14-17-6-3-2-4-7-17)26-22(20)18-9-11-19(24)12-10-18/h2-4,6-7,9-12,15-16,21H,5,8,13-14H2,1H3,(H,25,28)/t16-,21-/m1/s1 |
| InChIKey | LZGJTEMWSDYURM-IIBYNOLFSA-N |
| XLogP | 4.55 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |