C16H18BrFN2S — CID 3524239
1-[(5-bromothiophen-2-yl)-(3-fluorophenyl)methyl]-1,4-diazepane (PubChem CID 3524239) has the molecular formula C16H18BrFN2S and a molecular weight of 369.30 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)-(3-fluorophenyl)methyl]-1,4-diazepane.
| Compound Name | 1-[(5-bromothiophen-2-yl)-(3-fluorophenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3524239 |
| Molecular Formula | C16H18BrFN2S |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)-(3-fluorophenyl)methyl]-1,4-diazepane |
| SMILES | Fc1cccc(C(c2ccc(Br)s2)N2CCCNCC2)c1 |
| InChI | InChI=1S/C16H18BrFN2S/c17-15-6-5-14(21-15)16(12-3-1-4-13(18)11-12)20-9-2-7-19-8-10-20/h1,3-6,11,16,19H,2,7-10H2 |
| InChIKey | MFUFXRMSHMPBEH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |