C25H26N4O4 — CID 3524504
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-6-(1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 3524504) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-6-(1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-6-(1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 3524504 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-6-(1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | Cc1c(NC(=O)CCCCCN2C(=O)c3ccccc3C2=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H26N4O4/c1-17-22(25(33)29(27(17)2)18-11-5-3-6-12-18)26-21(30)15-7-4-10-16-28-23(31)19-13-8-9-14-20(19)24(28)32/h3,5-6,8-9,11-14H,4,7,10,15-16H2,1-2H3,(H,26,30) |
| InChIKey | SNZRZRBNTFIVQL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|