C20H23ClN2O — CID 3525870
4-[6-chloro-2-(4-methoxyphenyl)-7-methyl-1H-indol-3-yl]butan-1-amine (PubChem CID 3525870) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is 4-[6-chloro-2-(4-methoxyphenyl)-7-methyl-1H-indol-3-yl]butan-1-amine.
| Compound Name | 4-[6-chloro-2-(4-methoxyphenyl)-7-methyl-1H-indol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 3525870 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 4-[6-chloro-2-(4-methoxyphenyl)-7-methyl-1H-indol-3-yl]butan-1-amine |
| SMILES | COc1ccc(-c2[nH]c3c(C)c(Cl)ccc3c2CCCCN)cc1 |
| InChI | InChI=1S/C20H23ClN2O/c1-13-18(21)11-10-17-16(5-3-4-12-22)20(23-19(13)17)14-6-8-15(24-2)9-7-14/h6-11,23H,3-5,12,22H2,1-2H3 |
| InChIKey | GWMJLPUFOABKMT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|