C19H16NO4S- — CID 3526274
3-[1-(3-methoxycarbonylphenyl)-5-thiophen-2-ylpyrrol-2-yl]propanoate (PubChem CID 3526274) has the molecular formula C19H16NO4S- and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-[1-(3-methoxycarbonylphenyl)-5-thiophen-2-ylpyrrol-2-yl]propanoate.
| Compound Name | 3-[1-(3-methoxycarbonylphenyl)-5-thiophen-2-ylpyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 3526274 |
| Molecular Formula | C19H16NO4S- |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 3-[1-(3-methoxycarbonylphenyl)-5-thiophen-2-ylpyrrol-2-yl]propanoate |
| SMILES | COC(=O)c1cccc(-n2c(CCC(=O)[O-])ccc2-c2cccs2)c1 |
| InChI | InChI=1S/C19H17NO4S/c1-24-19(23)13-4-2-5-15(12-13)20-14(8-10-18(21)22)7-9-16(20)17-6-3-11-25-17/h2-7,9,11-12H,8,10H2,1H3,(H,21,22)/p-1 |
| InChIKey | SYHQAWOZQRZIIG-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 71.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|