C25H22O5 — CID 3526800
[4-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]phenyl] 2-methylbenzoate (PubChem CID 3526800) has the molecular formula C25H22O5 and a molecular weight of 402.45 g/mol. Its IUPAC name is [4-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]phenyl] 2-methylbenzoate.
| Compound Name | [4-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 3526800 |
| Molecular Formula | C25H22O5 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [4-[3-(2,5-dimethoxyphenyl)prop-2-enoyl]phenyl] 2-methylbenzoate |
| SMILES | COc1ccc(OC)c(C=CC(=O)c2ccc(OC(=O)c3ccccc3C)cc2)c1 |
| InChI | InChI=1S/C25H22O5/c1-17-6-4-5-7-22(17)25(27)30-20-11-8-18(9-12-20)23(26)14-10-19-16-21(28-2)13-15-24(19)29-3/h4-16H,1-3H3 |
| InChIKey | WFQBGERGQSJYSE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|