About 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one
2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one (PubChem CID 3527156) has the molecular formula C12H21N5O5
and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one |
| PubChem CID | 3527156 |
| Molecular Formula | C12H21N5O5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one |
| SMILES | CCOC(CN(C)c1nc(N)n(C)c(=O)c1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C12H21N5O5/c1-5-21-8(22-6-2)7-15(3)10-9(17(19)20)11(18)16(4)12(13)14-10/h8H,5-7H2,1-4H3,(H2,13,14) |
| InChIKey | HDFQURMRMKQSHG-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one?
The IUPAC name of 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one (CID 3527156) is 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one.
What is the SMILES notation for 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one?
The canonical SMILES for 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one is CCOC(CN(C)c1nc(N)n(C)c(=O)c1[N+](=O)[O-])OCC.
What is the InChIKey of 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one?
The InChIKey is HDFQURMRMKQSHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N5O5/c1-5-21-8(22-6-2)7-15(3)10-9(17(19)20)11(18)16(4)12(13)14-10/h8H,5-7H2,1-4H3,(H2,13,14).
What are the key properties of 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one?
2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one has a molecular weight of 315.33 g/mol, XLogP of 0.11, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-[2,2-diethoxyethyl(methyl)amino]-3-methyl-5-nitropyrimidin-4-one is sourced from PubChem (CID 3527156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).