C19H19BrN4O4 — CID 3527373
N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-bromobenzamide (PubChem CID 3527373) has the molecular formula C19H19BrN4O4 and a molecular weight of 447.29 g/mol. Its IUPAC name is N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-bromobenzamide.
| Compound Name | N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-bromobenzamide |
|---|---|
| PubChem CID | 3527373 |
| Molecular Formula | C19H19BrN4O4 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | N-[[1-(2-bicyclo[2.2.1]heptanyl)-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]-4-bromobenzamide |
| SMILES | O=C(NN=CC1C(=O)NC(=O)N(C2CC3CCC2C3)C1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H19BrN4O4/c20-13-5-3-11(4-6-13)16(25)23-21-9-14-17(26)22-19(28)24(18(14)27)15-8-10-1-2-12(15)7-10/h3-6,9-10,12,14-15H,1-2,7-8H2,(H,23,25)(H,22,26,28) |
| InChIKey | MLMXWTOVMCDVGH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|