C26H22N2O4S — CID 3527583
8'-methoxy-1,1,3-trimethyl-6'-nitrospiro[[1]benzothiolo[2,3-e]indole-2,2'-chromene] (PubChem CID 3527583) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is 8'-methoxy-1,1,3-trimethyl-6'-nitrospiro[[1]benzothiolo[2,3-e]indole-2,2'-chromene].
| Compound Name | 8'-methoxy-1,1,3-trimethyl-6'-nitrospiro[[1]benzothiolo[2,3-e]indole-2,2'-chromene] |
|---|---|
| PubChem CID | 3527583 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 8'-methoxy-1,1,3-trimethyl-6'-nitrospiro[[1]benzothiolo[2,3-e]indole-2,2'-chromene] |
| SMILES | COc1cc([N+](=O)[O-])cc2c1OC1(C=C2)N(C)c2ccc3c(sc4ccccc43)c2C1(C)C |
| InChI | InChI=1S/C26H22N2O4S/c1-25(2)22-19(10-9-18-17-7-5-6-8-21(17)33-24(18)22)27(3)26(25)12-11-15-13-16(28(29)30)14-20(31-4)23(15)32-26/h5-14H,1-4H3 |
| InChIKey | SPYPNEXPKHCSCL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|