C32H28N2O12 — CID 3527756
[3-[5-(3-benzoyloxy-1-ethoxy-1-oxobut-2-en-2-yl)-2,4-dinitrophenyl]-4-ethoxy-4-oxobut-2-en-2-yl] benzoate (PubChem CID 3527756) has the molecular formula C32H28N2O12 and a molecular weight of 632.58 g/mol. Its IUPAC name is [3-[5-(3-benzoyloxy-1-ethoxy-1-oxobut-2-en-2-yl)-2,4-dinitrophenyl]-4-ethoxy-4-oxobut-2-en-2-yl] benzoate.
| Compound Name | [3-[5-(3-benzoyloxy-1-ethoxy-1-oxobut-2-en-2-yl)-2,4-dinitrophenyl]-4-ethoxy-4-oxobut-2-en-2-yl] benzoate |
|---|---|
| PubChem CID | 3527756 |
| Molecular Formula | C32H28N2O12 |
| Molecular Weight | 632.58 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | [3-[5-(3-benzoyloxy-1-ethoxy-1-oxobut-2-en-2-yl)-2,4-dinitrophenyl]-4-ethoxy-4-oxobut-2-en-2-yl] benzoate |
| SMILES | CCOC(=O)C(=C(C)OC(=O)c1ccccc1)c1cc(C(C(=O)OCC)=C(C)OC(=O)c2ccccc2)c([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H28N2O12/c1-5-43-31(37)27(19(3)45-29(35)21-13-9-7-10-14-21)23-17-24(26(34(41)42)18-25(23)33(39)40)28(32(38)44-6-2)20(4)46-30(36)22-15-11-8-12-16-22/h7-18H,5-6H2,1-4H3 |
| InChIKey | QMMDWKLQOPFQGC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 191.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|