C16H21BrN4O — CID 35281038
1-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]-3-butylurea (PubChem CID 35281038) has the molecular formula C16H21BrN4O and a molecular weight of 365.28 g/mol. Its IUPAC name is 1-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]-3-butylurea.
| Compound Name | 1-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]-3-butylurea |
|---|---|
| PubChem CID | 35281038 |
| Molecular Formula | C16H21BrN4O |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 1-[4-(4-bromo-3,5-dimethylpyrazol-1-yl)phenyl]-3-butylurea |
| SMILES | CCCCNC(=O)Nc1ccc(-n2nc(C)c(Br)c2C)cc1 |
| InChI | InChI=1S/C16H21BrN4O/c1-4-5-10-18-16(22)19-13-6-8-14(9-7-13)21-12(3)15(17)11(2)20-21/h6-9H,4-5,10H2,1-3H3,(H2,18,19,22) |
| InChIKey | CBBIITUIJDXDEG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|