C20H22BrN3O3S — CID 3528224
3-bromo-4-methyl-N-[[[2-(2-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]benzamide (PubChem CID 3528224) has the molecular formula C20H22BrN3O3S and a molecular weight of 464.39 g/mol. Its IUPAC name is 3-bromo-4-methyl-N-[[[2-(2-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-methyl-N-[[[2-(2-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3528224 |
| Molecular Formula | C20H22BrN3O3S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 3-bromo-4-methyl-N-[[[2-(2-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)NNC(=O)COc2ccccc2C(C)C)cc1Br |
| InChI | InChI=1S/C20H22BrN3O3S/c1-12(2)15-6-4-5-7-17(15)27-11-18(25)23-24-20(28)22-19(26)14-9-8-13(3)16(21)10-14/h4-10,12H,11H2,1-3H3,(H,23,25)(H2,22,24,26,28) |
| InChIKey | BURJADAMTXTKHM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|