About 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile
6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 3528661) has the molecular formula C26H20N4O2
and a molecular weight of 420.47 g/mol. Its IUPAC name is 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| PubChem CID | 3528661 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | COc1ccc(C2C(C#N)=C(N)Oc3c2c(-c2ccccc2)nn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H20N4O2/c1-31-20-14-12-17(13-15-20)22-21(16-27)25(28)32-26-23(22)24(18-8-4-2-5-9-18)29-30(26)19-10-6-3-7-11-19/h2-15,22H,28H2,1H3 |
| InChIKey | OOCJZFSWSZJDAT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile?
The IUPAC name of 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (CID 3528661) is 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
What is the SMILES notation for 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile?
The canonical SMILES for 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile is COc1ccc(C2C(C#N)=C(N)Oc3c2c(-c2ccccc2)nn3-c2ccccc2)cc1.
What is the InChIKey of 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile?
The InChIKey is OOCJZFSWSZJDAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N4O2/c1-31-20-14-12-17(13-15-20)22-21(16-27)25(28)32-26-23(22)24(18-8-4-2-5-9-18)29-30(26)19-10-6-3-7-11-19/h2-15,22H,28H2,1H3.
What are the key properties of 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile?
6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile has a molecular weight of 420.47 g/mol, XLogP of 4.77, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-(4-methoxyphenyl)-1,3-diphenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile is sourced from PubChem (CID 3528661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).