C14H26N2O2S — CID 35295600
(2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylpiperidine-1-sulfonamide (PubChem CID 35295600) has the molecular formula C14H26N2O2S and a molecular weight of 286.44 g/mol. Its IUPAC name is (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylpiperidine-1-sulfonamide.
| Compound Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 35295600 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-2-methylpiperidine-1-sulfonamide |
| SMILES | C[C@H]1CCCCN1S(=O)(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C14H26N2O2S/c1-13-7-5-6-12-16(13)19(17,18)15-11-10-14-8-3-2-4-9-14/h8,13,15H,2-7,9-12H2,1H3/t13-/m0/s1 |
| InChIKey | PUMKEZLEAHADAT-ZDUSSCGKSA-N |
| XLogP | 2.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|