About [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate
[2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 3529980) has the molecular formula C17H14N2O3
and a molecular weight of 294.31 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate |
| PubChem CID | 3529980 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C17H14N2O3/c1-12-5-7-13(8-6-12)15(20)11-22-17(21)14-10-19-9-3-2-4-16(19)18-14/h2-10H,11H2,1H3 |
| InChIKey | IYBNUXDEJIBRAL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate?
The IUPAC name of [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate (CID 3529980) is [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate.
What is the SMILES notation for [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate?
The canonical SMILES for [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate is Cc1ccc(C(=O)COC(=O)c2cn3ccccc3n2)cc1.
What is the InChIKey of [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate?
The InChIKey is IYBNUXDEJIBRAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3/c1-12-5-7-13(8-6-12)15(20)11-22-17(21)14-10-19-9-3-2-4-16(19)18-14/h2-10H,11H2,1H3.
What are the key properties of [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate?
[2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate has a molecular weight of 294.31 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylphenyl)-2-oxoethyl] imidazo[1,2-a]pyridine-2-carboxylate is sourced from PubChem (CID 3529980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).