About 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide
2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide (PubChem CID 35300602) has the molecular formula C21H30N4O2
and a molecular weight of 370.50 g/mol. Its IUPAC name is 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide.
Molecular Properties
| Compound Name | 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide |
| PubChem CID | 35300602 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide |
| SMILES | Cc1nn(CC(=O)N(C2CCCCC2)C2CCCCC2)c(=O)c(C#N)c1C |
| InChI | InChI=1S/C21H30N4O2/c1-15-16(2)23-24(21(27)19(15)13-22)14-20(26)25(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h17-18H,3-12,14H2,1-2H3 |
| InChIKey | DZJCIBCRDBEQOB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide?
The IUPAC name of 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide (CID 35300602) is 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide.
What is the SMILES notation for 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide?
The canonical SMILES for 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide is Cc1nn(CC(=O)N(C2CCCCC2)C2CCCCC2)c(=O)c(C#N)c1C.
What is the InChIKey of 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide?
The InChIKey is DZJCIBCRDBEQOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4O2/c1-15-16(2)23-24(21(27)19(15)13-22)14-20(26)25(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h17-18H,3-12,14H2,1-2H3.
What are the key properties of 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide?
2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide has a molecular weight of 370.50 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyano-3,4-dimethyl-6-oxopyridazin-1-yl)-N,N-dicyclohexylacetamide is sourced from PubChem (CID 35300602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).