C19H23N3O4S — CID 35304004
N-ethyl-2-[[3-(propan-2-ylsulfamoyl)benzoyl]amino]benzamide (PubChem CID 35304004) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-ethyl-2-[[3-(propan-2-ylsulfamoyl)benzoyl]amino]benzamide.
| Compound Name | N-ethyl-2-[[3-(propan-2-ylsulfamoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 35304004 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-ethyl-2-[[3-(propan-2-ylsulfamoyl)benzoyl]amino]benzamide |
| SMILES | CCNC(=O)c1ccccc1NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1 |
| InChI | InChI=1S/C19H23N3O4S/c1-4-20-19(24)16-10-5-6-11-17(16)21-18(23)14-8-7-9-15(12-14)27(25,26)22-13(2)3/h5-13,22H,4H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | UTSGOWYLDVPQIQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |