C22H33N3OS — CID 3530645
1-[[5-[[butyl(ethyl)amino]methyl]furan-2-yl]methyl]-3-(2,4,6-trimethylphenyl)thiourea (PubChem CID 3530645) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is 1-[[5-[[butyl(ethyl)amino]methyl]furan-2-yl]methyl]-3-(2,4,6-trimethylphenyl)thiourea.
| Compound Name | 1-[[5-[[butyl(ethyl)amino]methyl]furan-2-yl]methyl]-3-(2,4,6-trimethylphenyl)thiourea |
|---|---|
| PubChem CID | 3530645 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-[[5-[[butyl(ethyl)amino]methyl]furan-2-yl]methyl]-3-(2,4,6-trimethylphenyl)thiourea |
| SMILES | CCCCN(CC)Cc1ccc(CNC(=S)Nc2c(C)cc(C)cc2C)o1 |
| InChI | InChI=1S/C22H33N3OS/c1-6-8-11-25(7-2)15-20-10-9-19(26-20)14-23-22(27)24-21-17(4)12-16(3)13-18(21)5/h9-10,12-13H,6-8,11,14-15H2,1-5H3,(H2,23,24,27) |
| InChIKey | NMRNOEIYVKKYDF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|