C21H25FN4OS — CID 3530847
1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)thiourea (PubChem CID 3530847) has the molecular formula C21H25FN4OS and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)thiourea.
| Compound Name | 1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3530847 |
| Molecular Formula | C21H25FN4OS |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-3-(2-methoxyethyl)-1-(pyridin-4-ylmethyl)thiourea |
| SMILES | COCCNC(=S)N(CCc1c(C)[nH]c2ccc(F)cc12)Cc1ccncc1 |
| InChI | InChI=1S/C21H25FN4OS/c1-15-18(19-13-17(22)3-4-20(19)25-15)7-11-26(21(28)24-10-12-27-2)14-16-5-8-23-9-6-16/h3-6,8-9,13,25H,7,10-12,14H2,1-2H3,(H,24,28) |
| InChIKey | IPQQTVYSFWMNDV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|