About 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide
5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide (PubChem CID 35311783) has the molecular formula C10H14ClN5O2S
and a molecular weight of 303.78 g/mol. Its IUPAC name is 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide |
| PubChem CID | 35311783 |
| Molecular Formula | C10H14ClN5O2S |
| Molecular Weight | 303.78 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide |
| SMILES | CN(Cc1cnn(C)c1)S(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C10H14ClN5O2S/c1-14-7-12-10(9(14)11)19(17,18)16(3)6-8-4-13-15(2)5-8/h4-5,7H,6H2,1-3H3 |
| InChIKey | DTRWNSRBYMAUBV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.78 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide?
The IUPAC name of 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide (CID 35311783) is 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide.
What is the SMILES notation for 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide?
The canonical SMILES for 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide is CN(Cc1cnn(C)c1)S(=O)(=O)c1ncn(C)c1Cl.
What is the InChIKey of 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide?
The InChIKey is DTRWNSRBYMAUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN5O2S/c1-14-7-12-10(9(14)11)19(17,18)16(3)6-8-4-13-15(2)5-8/h4-5,7H,6H2,1-3H3.
What are the key properties of 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide?
5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide has a molecular weight of 303.78 g/mol, XLogP of 0.63, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N,1-dimethyl-N-[(1-methylpyrazol-4-yl)methyl]imidazole-4-sulfonamide is sourced from PubChem (CID 35311783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).