C28H24N2O10 — CID 3531275
dimethyl 5-[[4-[[3,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoyl]amino]benzene-1,3-dicarboxylate (PubChem CID 3531275) has the molecular formula C28H24N2O10 and a molecular weight of 548.50 g/mol. Its IUPAC name is dimethyl 5-[[4-[[3,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[4-[[3,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3531275 |
| Molecular Formula | C28H24N2O10 |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | dimethyl 5-[[4-[[3,5-bis(methoxycarbonyl)phenyl]carbamoyl]benzoyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccc(C(=O)Nc3cc(C(=O)OC)cc(C(=O)OC)c3)cc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C28H24N2O10/c1-37-25(33)17-9-18(26(34)38-2)12-21(11-17)29-23(31)15-5-7-16(8-6-15)24(32)30-22-13-19(27(35)39-3)10-20(14-22)28(36)40-4/h5-14H,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | RLZQINXRCVKHGV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|