About 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole
5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole (PubChem CID 3531352) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole |
| PubChem CID | 3531352 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole |
| SMILES | CCC(C)c1ccc2c(c1)CC(c1ccccn1)N2 |
| InChI | InChI=1S/C17H20N2/c1-3-12(2)13-7-8-15-14(10-13)11-17(19-15)16-6-4-5-9-18-16/h4-10,12,17,19H,3,11H2,1-2H3 |
| InChIKey | IMKMGAPLSQFCKP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole?
The IUPAC name of 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole (CID 3531352) is 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole.
What is the SMILES notation for 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole?
The canonical SMILES for 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole is CCC(C)c1ccc2c(c1)CC(c1ccccn1)N2.
What is the InChIKey of 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole?
The InChIKey is IMKMGAPLSQFCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2/c1-3-12(2)13-7-8-15-14(10-13)11-17(19-15)16-6-4-5-9-18-16/h4-10,12,17,19H,3,11H2,1-2H3.
What are the key properties of 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole?
5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole has a molecular weight of 252.36 g/mol, XLogP of 4.30, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-2-pyridin-2-yl-2,3-dihydro-1H-indole is sourced from PubChem (CID 3531352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).