C16H16N6OS — CID 3531495
2-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide (PubChem CID 3531495) has the molecular formula C16H16N6OS and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide.
| Compound Name | 2-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 3531495 |
| Molecular Formula | C16H16N6OS |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetohydrazide |
| SMILES | NNC(=O)CSc1nnc(-c2ccncc2)n1Cc1ccccc1 |
| InChI | InChI=1S/C16H16N6OS/c17-19-14(23)11-24-16-21-20-15(13-6-8-18-9-7-13)22(16)10-12-4-2-1-3-5-12/h1-9H,10-11,17H2,(H,19,23) |
| InChIKey | DPCOSXCVEATRNO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|