C14H10O2 — CID 3532222
15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,6,9,13-pentaene (PubChem CID 3532222) has the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. Its IUPAC name is 15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,6,9,13-pentaene.
| Compound Name | 15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,6,9,13-pentaene |
|---|---|
| PubChem CID | 3532222 |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,6,9,13-pentaene |
| SMILES | C1=CC2OC1c1cc3c(cc12)C1C=CC3O1 |
| InChI | InChI=1S/C14H10O2/c1-2-12-8-6-10-9(5-7(8)11(1)15-12)13-3-4-14(10)16-13/h1-6,11-14H |
| InChIKey | KGWFDDIOZVPOTL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|