C19H15F2N3O2 — CID 3532229
5-[2-(3,5-difluorophenyl)acetyl]-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one (PubChem CID 3532229) has the molecular formula C19H15F2N3O2 and a molecular weight of 355.34 g/mol. Its IUPAC name is 5-[2-(3,5-difluorophenyl)acetyl]-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one.
| Compound Name | 5-[2-(3,5-difluorophenyl)acetyl]-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one |
|---|---|
| PubChem CID | 3532229 |
| Molecular Formula | C19H15F2N3O2 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 5-[2-(3,5-difluorophenyl)acetyl]-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one |
| SMILES | O=C(Cc1cc(F)cc(F)c1)N1CCc2nc3ccccn3c(=O)c2C1 |
| InChI | InChI=1S/C19H15F2N3O2/c20-13-7-12(8-14(21)10-13)9-18(25)23-6-4-16-15(11-23)19(26)24-5-2-1-3-17(24)22-16/h1-3,5,7-8,10H,4,6,9,11H2 |
| InChIKey | YZCBRJSCLJCEBD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |