C27H25ClN4O2S — CID 3532320
2-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]sulfanyl-3-(3-chlorophenyl)quinazolin-4-one (PubChem CID 3532320) has the molecular formula C27H25ClN4O2S and a molecular weight of 505.04 g/mol. Its IUPAC name is 2-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]sulfanyl-3-(3-chlorophenyl)quinazolin-4-one.
| Compound Name | 2-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]sulfanyl-3-(3-chlorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 3532320 |
| Molecular Formula | C27H25ClN4O2S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 2-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]sulfanyl-3-(3-chlorophenyl)quinazolin-4-one |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1cccc(Cl)c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H25ClN4O2S/c28-21-9-6-10-22(17-21)32-26(34)23-11-4-5-12-24(23)29-27(32)35-19-25(33)31-15-13-30(14-16-31)18-20-7-2-1-3-8-20/h1-12,17H,13-16,18-19H2 |
| InChIKey | WBJHBQUGFNTQAG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |