C11H18F3N3O2S — CID 35323866
1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-4-(trifluoromethyl)cyclohexane (PubChem CID 35323866) has the molecular formula C11H18F3N3O2S and a molecular weight of 313.35 g/mol. Its IUPAC name is 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-4-(trifluoromethyl)cyclohexane.
| Compound Name | 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-4-(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 35323866 |
| Molecular Formula | C11H18F3N3O2S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-4-(trifluoromethyl)cyclohexane |
| SMILES | CN(CCC#N)S(=O)(=O)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3N3O2S/c1-17(8-2-7-15)20(18,19)16-10-5-3-9(4-6-10)11(12,13)14/h9-10,16H,2-6,8H2,1H3 |
| InChIKey | UHJVOTLOUSJNFB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |