About 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide
2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 3532542) has the molecular formula C16H13ClF3NO4S
and a molecular weight of 407.80 g/mol. Its IUPAC name is 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 3532542 |
| Molecular Formula | C16H13ClF3NO4S |
| Molecular Weight | 407.80 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OCCCO2)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H13ClF3NO4S/c17-12-4-2-10(16(18,19)20)8-15(12)26(22,23)21-11-3-5-13-14(9-11)25-7-1-6-24-13/h2-5,8-9,21H,1,6-7H2 |
| InChIKey | WTSJUABJTWWLPZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide (CID 3532542) is 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide is O=S(=O)(Nc1ccc2c(c1)OCCCO2)c1cc(C(F)(F)F)ccc1Cl.
What is the InChIKey of 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide?
The InChIKey is WTSJUABJTWWLPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClF3NO4S/c17-12-4-2-10(16(18,19)20)8-15(12)26(22,23)21-11-3-5-13-14(9-11)25-7-1-6-24-13/h2-5,8-9,21H,1,6-7H2.
What are the key properties of 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide?
2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide has a molecular weight of 407.80 g/mol, XLogP of 4.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 3532542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).