About (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate
(4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate (PubChem CID 3532610) has the molecular formula C19H16N2O2
and a molecular weight of 304.35 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate.
Molecular Properties
| Compound Name | (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate |
| PubChem CID | 3532610 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate |
| SMILES | N#Cc1ccc(COC(=O)CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C19H16N2O2/c20-11-14-5-7-15(8-6-14)13-23-19(22)10-9-16-12-21-18-4-2-1-3-17(16)18/h1-8,12,21H,9-10,13H2 |
| InChIKey | SKMPTZGRAZAJDL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate?
The IUPAC name of (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate (CID 3532610) is (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate.
What is the SMILES notation for (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate?
The canonical SMILES for (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate is N#Cc1ccc(COC(=O)CCc2c[nH]c3ccccc23)cc1.
What is the InChIKey of (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate?
The InChIKey is SKMPTZGRAZAJDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O2/c20-11-14-5-7-15(8-6-14)13-23-19(22)10-9-16-12-21-18-4-2-1-3-17(16)18/h1-8,12,21H,9-10,13H2.
What are the key properties of (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate?
(4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate has a molecular weight of 304.35 g/mol, XLogP of 3.72, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 3-(1H-indol-3-yl)propanoate is sourced from PubChem (CID 3532610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).