About [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate
[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 3533006) has the molecular formula C21H24N2O3
and a molecular weight of 352.43 g/mol. Its IUPAC name is [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate.
Molecular Properties
| Compound Name | [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate |
| PubChem CID | 3533006 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | CC(NC(=O)COC(=O)c1ccc2ccccc2n1)C1CC2CCC1C2 |
| InChI | InChI=1S/C21H24N2O3/c1-13(17-11-14-6-7-16(17)10-14)22-20(24)12-26-21(25)19-9-8-15-4-2-3-5-18(15)23-19/h2-5,8-9,13-14,16-17H,6-7,10-12H2,1H3,(H,22,24) |
| InChIKey | NMAMANILFJYJBL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate?
The IUPAC name of [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate (CID 3533006) is [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate.
What is the SMILES notation for [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate?
The canonical SMILES for [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate is CC(NC(=O)COC(=O)c1ccc2ccccc2n1)C1CC2CCC1C2.
What is the InChIKey of [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate?
The InChIKey is NMAMANILFJYJBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O3/c1-13(17-11-14-6-7-16(17)10-14)22-20(24)12-26-21(25)19-9-8-15-4-2-3-5-18(15)23-19/h2-5,8-9,13-14,16-17H,6-7,10-12H2,1H3,(H,22,24).
What are the key properties of [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate?
[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate has a molecular weight of 352.43 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] quinoline-2-carboxylate is sourced from PubChem (CID 3533006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).