About N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide
N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide (PubChem CID 3533739) has the molecular formula C19H18N4O4S
and a molecular weight of 398.40 g/mol. Its IUPAC name is N-[2-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]ethyl]acetamide.
Molecular Properties
| Compound Name | N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide |
| PubChem CID | 3533739 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-[2-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCN1C(=O)C2=CC=CC=C2N=C1SCC3=CC(=CC=C3)[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N4O4S/c1-13(24)20-9-10-22-18(25)16-7-2-3-8-17(16)21-19(22)28-12-14-5-4-6-15(11-14)23(26)27/h2-8,11H,9-10,12H2,1H3,(H,20,24) |
| InChIKey | NUSJIXAWKQLMOW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | 636 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide?
The IUPAC name of N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide (CID 3533739) is N-[2-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxoquinazolin-3-yl]ethyl]acetamide.
What is the SMILES notation for N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide?
The canonical SMILES for N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide is CC(=O)NCCN1C(=O)C2=CC=CC=C2N=C1SCC3=CC(=CC=C3)[N+](=O)[O-].
What is the InChIKey of N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide?
The InChIKey is NUSJIXAWKQLMOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O4S/c1-13(24)20-9-10-22-18(25)16-7-2-3-8-17(16)21-19(22)28-12-14-5-4-6-15(11-14)23(26)27/h2-8,11H,9-10,12H2,1H3,(H,20,24).
What are the key properties of N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide?
N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide has a molecular weight of 398.40 g/mol, XLogP of 2.50, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-{2-[2-[(3-nitrobenzyl)thio]-4-oxoquinazolin-3(4H)-yl]ethyl}acetamide is sourced from PubChem (CID 3533739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).