About methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate
methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate (PubChem CID 35338882) has the molecular formula C21H23NO4
and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate |
| PubChem CID | 35338882 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate |
| SMILES | COC(=O)Cc1cc2c(n1-c1ccc(C(C)=O)cc1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C21H23NO4/c1-13(23)14-5-7-15(8-6-14)22-16(10-20(25)26-4)9-17-18(22)11-21(2,3)12-19(17)24/h5-9H,10-12H2,1-4H3 |
| InChIKey | NYDSJNNIKWTRQW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate?
The IUPAC name of methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate (CID 35338882) is methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate.
What is the SMILES notation for methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate?
The canonical SMILES for methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate is COC(=O)Cc1cc2c(n1-c1ccc(C(C)=O)cc1)CC(C)(C)CC2=O.
What is the InChIKey of methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate?
The InChIKey is NYDSJNNIKWTRQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO4/c1-13(23)14-5-7-15(8-6-14)22-16(10-20(25)26-4)9-17-18(22)11-21(2,3)12-19(17)24/h5-9H,10-12H2,1-4H3.
What are the key properties of methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate?
methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate has a molecular weight of 353.42 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(4-acetylphenyl)-6,6-dimethyl-4-oxo-5,7-dihydroindol-2-yl]acetate is sourced from PubChem (CID 35338882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).