C18H19N5OS — CID 3534
5-(4-morpholin-4-ylphenyl)sulfanylquinazoline-2,4-diamine (PubChem CID 3534) has the molecular formula C18H19N5OS and a molecular weight of 353.45 g/mol. Its IUPAC name is 5-(4-morpholin-4-ylphenyl)sulfanylquinazoline-2,4-diamine.
| Compound Name | 5-(4-morpholin-4-ylphenyl)sulfanylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 3534 |
| Molecular Formula | C18H19N5OS |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 5-(4-morpholin-4-ylphenyl)sulfanylquinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2c(Sc3ccc(N4CCOCC4)cc3)cccc2n1 |
| InChI | InChI=1S/C18H19N5OS/c19-17-16-14(21-18(20)22-17)2-1-3-15(16)25-13-6-4-12(5-7-13)23-8-10-24-11-9-23/h1-7H,8-11H2,(H4,19,20,21,22) |
| InChIKey | CZLWCJRHDBTCGQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |