C21H17F3N6OS2 — CID 35340966
N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxamide (PubChem CID 35340966) has the molecular formula C21H17F3N6OS2 and a molecular weight of 490.54 g/mol. Its IUPAC name is N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 35340966 |
| Molecular Formula | C21H17F3N6OS2 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | N-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-5-thiophen-2-yl-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CN1CCc2nc(NC(=O)c3nc(-c4cccs4)n(-c4cccc(C(F)(F)F)c4)n3)sc2C1 |
| InChI | InChI=1S/C21H17F3N6OS2/c1-29-8-7-14-16(11-29)33-20(25-14)27-19(31)17-26-18(15-6-3-9-32-15)30(28-17)13-5-2-4-12(10-13)21(22,23)24/h2-6,9-10H,7-8,11H2,1H3,(H,25,27,31) |
| InChIKey | YSFPREPZOCYVPK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |