C28H26N2O5S2 — CID 3534276
5-[[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]-5-nitrophenyl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3534276) has the molecular formula C28H26N2O5S2 and a molecular weight of 534.66 g/mol. Its IUPAC name is 5-[[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]-5-nitrophenyl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]-5-nitrophenyl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3534276 |
| Molecular Formula | C28H26N2O5S2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 5-[[2-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]-5-nitrophenyl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(C(C)C)c(OCCOc2ccc([N+](=O)[O-])cc2C=C2SC(=S)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C28H26N2O5S2/c1-18(2)23-11-9-19(3)15-25(23)35-14-13-34-24-12-10-22(30(32)33)16-20(24)17-26-27(31)29(28(36)37-26)21-7-5-4-6-8-21/h4-12,15-18H,13-14H2,1-3H3 |
| InChIKey | ZTJRFVDLKSRNPL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|