C42H37ClN2O7 — CID 3534284
8-(3-chlorophenyl)-6-[2-(2-hydroxyethoxy)phenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3534284) has the molecular formula C42H37ClN2O7 and a molecular weight of 717.22 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-6-[2-(2-hydroxyethoxy)phenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(3-chlorophenyl)-6-[2-(2-hydroxyethoxy)phenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3534284 |
| Molecular Formula | C42H37ClN2O7 |
| Molecular Weight | 717.22 g/mol |
| Exact Mass | 716.23 |
| IUPAC Name | 8-(3-chlorophenyl)-6-[2-(2-hydroxyethoxy)phenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5cccc(Cl)c5)C(=O)C4(c4ccccc4)C3c3ccccc3OCCO)C2C(=O)N1CCc1ccc(O)cc1 |
| InChI | InChI=1S/C42H37ClN2O7/c43-27-9-6-10-28(23-27)45-39(49)34-24-33-30(17-18-32-36(33)40(50)44(38(32)48)20-19-25-13-15-29(47)16-14-25)37(31-11-4-5-12-35(31)52-22-21-46)42(34,41(45)51)26-7-2-1-3-8-26/h1-17,23,32-34,36-37,46-47H,18-22,24H2 |
| InChIKey | MCDFZARPDIHMGC-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.22 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|