C29H37N5O2S — CID 3534490
3-[N-(2-cyanoethyl)-4-[[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile (PubChem CID 3534490) has the molecular formula C29H37N5O2S and a molecular weight of 519.72 g/mol. Its IUPAC name is 3-[N-(2-cyanoethyl)-4-[[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile.
| Compound Name | 3-[N-(2-cyanoethyl)-4-[[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile |
|---|---|
| PubChem CID | 3534490 |
| Molecular Formula | C29H37N5O2S |
| Molecular Weight | 519.72 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 3-[N-(2-cyanoethyl)-4-[[8-(2,5-dimethylphenyl)sulfonyl-2,8-diazaspiro[4.5]decan-2-yl]methyl]anilino]propanenitrile |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCC3(CCN(Cc4ccc(N(CCC#N)CCC#N)cc4)C3)CC2)c1 |
| InChI | InChI=1S/C29H37N5O2S/c1-24-5-6-25(2)28(21-24)37(35,36)34-19-12-29(13-20-34)11-18-32(23-29)22-26-7-9-27(10-8-26)33(16-3-14-30)17-4-15-31/h5-10,21H,3-4,11-13,16-20,22-23H2,1-2H3 |
| InChIKey | KEQHGDDNZKABOP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 91.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|