C15H22N3O+ — CID 3534566
1-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)-3,3-dimethylbutan-2-ol (PubChem CID 3534566) has the molecular formula C15H22N3O+ and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)-3,3-dimethylbutan-2-ol.
| Compound Name | 1-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 3534566 |
| Molecular Formula | C15H22N3O+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-imidazo[1,2-a]benzimidazol-9-ium-4-yl)-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)Cn1c2[n+](c3ccccc31)CCN2 |
| InChI | InChI=1S/C15H21N3O/c1-15(2,3)13(19)10-18-12-7-5-4-6-11(12)17-9-8-16-14(17)18/h4-7,13,19H,8-10H2,1-3H3/p+1 |
| InChIKey | RSBBCUYYRRXEQV-UHFFFAOYSA-O |
| XLogP | 1.76 |
| TPSA | 41.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|