About N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide
N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide (PubChem CID 3535303) has the molecular formula C19H11F3N2OS
and a molecular weight of 372.37 g/mol. Its IUPAC name is N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide |
| PubChem CID | 3535303 |
| Molecular Formula | C19H11F3N2OS |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nc2ccc3ccccc3c2s1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H11F3N2OS/c20-19(21,22)13-6-3-5-12(10-13)17(25)24-18-23-15-9-8-11-4-1-2-7-14(11)16(15)26-18/h1-10H,(H,23,24,25) |
| InChIKey | AXYORSCESCYMIT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide?
The IUPAC name of N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide (CID 3535303) is N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide.
What is the SMILES notation for N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide?
The canonical SMILES for N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide is O=C(Nc1nc2ccc3ccccc3c2s1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide?
The InChIKey is AXYORSCESCYMIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11F3N2OS/c20-19(21,22)13-6-3-5-12(10-13)17(25)24-18-23-15-9-8-11-4-1-2-7-14(11)16(15)26-18/h1-10H,(H,23,24,25).
What are the key properties of N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide?
N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide has a molecular weight of 372.37 g/mol, XLogP of 5.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzo[g][1,3]benzothiazol-2-yl-3-(trifluoromethyl)benzamide is sourced from PubChem (CID 3535303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).