C20H16F3N3O2S — CID 3535499
2-(4-methyl-6-oxo-1-phenylpyrimidin-2-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 3535499) has the molecular formula C20H16F3N3O2S and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-(4-methyl-6-oxo-1-phenylpyrimidin-2-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-methyl-6-oxo-1-phenylpyrimidin-2-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3535499 |
| Molecular Formula | C20H16F3N3O2S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-(4-methyl-6-oxo-1-phenylpyrimidin-2-yl)sulfanyl-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc(=O)n(-c2ccccc2)c(SCC(=O)Nc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C20H16F3N3O2S/c1-13-11-18(28)26(14-7-3-2-4-8-14)19(24-13)29-12-17(27)25-16-10-6-5-9-15(16)20(21,22)23/h2-11H,12H2,1H3,(H,25,27) |
| InChIKey | NELHHUUEQGNXAI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |