About 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine
2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine (PubChem CID 3536003) has the molecular formula C13H9Br2NSn
and a molecular weight of 457.74 g/mol. Its IUPAC name is 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine.
Molecular Properties
| Compound Name | 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine |
| PubChem CID | 3536003 |
| Molecular Formula | C13H9Br2NSn |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 456.81 |
| IUPAC Name | 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine |
| SMILES | CN1c2ccc(Br)cc2[Sn]c2cc(Br)ccc21 |
| InChI | InChI=1S/C13H9Br2N.Sn/c1-16(12-6-2-10(14)3-7-12)13-8-4-11(15)5-9-13;/h2-6,8H,1H3; |
| InChIKey | ORIPOHJJFIZMLM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine?
The IUPAC name of 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine (CID 3536003) is 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine.
What is the SMILES notation for 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine?
The canonical SMILES for 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine is CN1c2ccc(Br)cc2[Sn]c2cc(Br)ccc21.
What is the InChIKey of 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine?
The InChIKey is ORIPOHJJFIZMLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Br2N.Sn/c1-16(12-6-2-10(14)3-7-12)13-8-4-11(15)5-9-13;/h2-6,8H,1H3;.
What are the key properties of 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine?
2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine has a molecular weight of 457.74 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dibromo-5-methylbenzo[b][1,4]benzazastannine is sourced from PubChem (CID 3536003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).